C20H16FNO3S — CID 78760384
(2-phenyl-1,3-thiazol-5-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 78760384) has the molecular formula C20H16FNO3S and a molecular weight of 369.42 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | (2-phenyl-1,3-thiazol-5-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 78760384 |
| Molecular Formula | C20H16FNO3S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)OCc1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C20H16FNO3S/c21-16-8-6-14(7-9-16)18(23)10-11-19(24)25-13-17-12-22-20(26-17)15-4-2-1-3-5-15/h1-9,12H,10-11,13H2 |
| InChIKey | VMWONUJZXSVSDP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |