C19H16N2O3S — CID 78760953
(2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamidobenzoate (PubChem CID 78760953) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamidobenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamidobenzoate |
|---|---|
| PubChem CID | 78760953 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCc2cnc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H16N2O3S/c1-13(22)21-16-9-5-8-15(10-16)19(23)24-12-17-11-20-18(25-17)14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | AGQJBCWKSCZMCE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |