C19H15FN2O4S — CID 75524740
[2-(1,3-thiazol-4-ylmethoxy)phenyl] 3-acetamido-4-fluorobenzoate (PubChem CID 75524740) has the molecular formula C19H15FN2O4S and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-(1,3-thiazol-4-ylmethoxy)phenyl] 3-acetamido-4-fluorobenzoate.
| Compound Name | [2-(1,3-thiazol-4-ylmethoxy)phenyl] 3-acetamido-4-fluorobenzoate |
|---|---|
| PubChem CID | 75524740 |
| Molecular Formula | C19H15FN2O4S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [2-(1,3-thiazol-4-ylmethoxy)phenyl] 3-acetamido-4-fluorobenzoate |
| SMILES | CC(=O)Nc1cc(C(=O)Oc2ccccc2OCc2cscn2)ccc1F |
| InChI | InChI=1S/C19H15FN2O4S/c1-12(23)22-16-8-13(6-7-15(16)20)19(24)26-18-5-3-2-4-17(18)25-9-14-10-27-11-21-14/h2-8,10-11H,9H2,1H3,(H,22,23) |
| InChIKey | INOHOAOPWSYTOY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|