C20H17ClN2O2S — CID 86883492
(Z)-3-(2-chlorophenyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]but-2-enamide (PubChem CID 86883492) has the molecular formula C20H17ClN2O2S and a molecular weight of 384.89 g/mol. Its IUPAC name is (Z)-3-(2-chlorophenyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]but-2-enamide.
| Compound Name | (Z)-3-(2-chlorophenyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 86883492 |
| Molecular Formula | C20H17ClN2O2S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (Z)-3-(2-chlorophenyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)Nc1ccccc1OCc1cscn1)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN2O2S/c1-14(16-6-2-3-7-17(16)21)10-20(24)23-18-8-4-5-9-19(18)25-11-15-12-26-13-22-15/h2-10,12-13H,11H2,1H3,(H,23,24)/b14-10- |
| InChIKey | LIDIHXOUJVDVJY-UVTDQMKNSA-N |
| XLogP | 5.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|