C15H17N3O3S — CID 78823301
N'-(2-methylpropanoyl)-2-(1,3-thiazol-4-ylmethoxy)benzohydrazide (PubChem CID 78823301) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N'-(2-methylpropanoyl)-2-(1,3-thiazol-4-ylmethoxy)benzohydrazide.
| Compound Name | N'-(2-methylpropanoyl)-2-(1,3-thiazol-4-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 78823301 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N'-(2-methylpropanoyl)-2-(1,3-thiazol-4-ylmethoxy)benzohydrazide |
| SMILES | CC(C)C(=O)NNC(=O)c1ccccc1OCc1cscn1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10(2)14(19)17-18-15(20)12-5-3-4-6-13(12)21-7-11-8-22-9-16-11/h3-6,8-10H,7H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | ZLSVMDVMXQTYFZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|