C21H21N3O3S2 — CID 55536973
N'-[2-(2-ethylphenoxy)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide (PubChem CID 55536973) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N'-[2-(2-ethylphenoxy)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide.
| Compound Name | N'-[2-(2-ethylphenoxy)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide |
|---|---|
| PubChem CID | 55536973 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N'-[2-(2-ethylphenoxy)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide |
| SMILES | CCc1ccccc1OCC(=O)NNC(=O)c1ccccc1SCc1cscn1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-2-15-7-3-5-9-18(15)27-11-20(25)23-24-21(26)17-8-4-6-10-19(17)29-13-16-12-28-14-22-16/h3-10,12,14H,2,11,13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | FVJVYJPZSFHOCB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|