C19H19N3O2S3 — CID 43048855
5-ethyl-4-methyl-N'-[2-(1,3-thiazol-4-ylmethylsulfanyl)benzoyl]thiophene-2-carbohydrazide (PubChem CID 43048855) has the molecular formula C19H19N3O2S3 and a molecular weight of 417.58 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-[2-(1,3-thiazol-4-ylmethylsulfanyl)benzoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-[2-(1,3-thiazol-4-ylmethylsulfanyl)benzoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 43048855 |
| Molecular Formula | C19H19N3O2S3 |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 5-ethyl-4-methyl-N'-[2-(1,3-thiazol-4-ylmethylsulfanyl)benzoyl]thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2ccccc2SCc2cscn2)cc1C |
| InChI | InChI=1S/C19H19N3O2S3/c1-3-15-12(2)8-17(27-15)19(24)22-21-18(23)14-6-4-5-7-16(14)26-10-13-9-25-11-20-13/h4-9,11H,3,10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | PDBXEAXARHDEEP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|