C16H13N3OS2 — CID 30887149
N-pyridin-3-yl-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide (PubChem CID 30887149) has the molecular formula C16H13N3OS2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-pyridin-3-yl-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide.
| Compound Name | N-pyridin-3-yl-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 30887149 |
| Molecular Formula | C16H13N3OS2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-pyridin-3-yl-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cccnc1)c1ccccc1SCc1cscn1 |
| InChI | InChI=1S/C16H13N3OS2/c20-16(19-12-4-3-7-17-8-12)14-5-1-2-6-15(14)22-10-13-9-21-11-18-13/h1-9,11H,10H2,(H,19,20) |
| InChIKey | UEYLLHSDBZPOIN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |