C19H16ClN3O2S2 — CID 55555197
N'-[2-(4-chlorophenyl)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide (PubChem CID 55555197) has the molecular formula C19H16ClN3O2S2 and a molecular weight of 417.94 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide |
|---|---|
| PubChem CID | 55555197 |
| Molecular Formula | C19H16ClN3O2S2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)c1ccccc1SCc1cscn1 |
| InChI | InChI=1S/C19H16ClN3O2S2/c20-14-7-5-13(6-8-14)9-18(24)22-23-19(25)16-3-1-2-4-17(16)27-11-15-10-26-12-21-15/h1-8,10,12H,9,11H2,(H,22,24)(H,23,25) |
| InChIKey | WPAHKMHYSNKLFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|