C20H15N3O2S2 — CID 86979350
N-(5-phenyl-1,3-thiazol-2-yl)-2-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 86979350) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(5-phenyl-1,3-thiazol-2-yl)-2-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(5-phenyl-1,3-thiazol-2-yl)-2-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 86979350 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(5-phenyl-1,3-thiazol-2-yl)-2-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | O=C(Nc1ncc(-c2ccccc2)s1)c1ccccc1OCc1cscn1 |
| InChI | InChI=1S/C20H15N3O2S2/c24-19(23-20-21-10-18(27-20)14-6-2-1-3-7-14)16-8-4-5-9-17(16)25-11-15-12-26-13-22-15/h1-10,12-13H,11H2,(H,21,23,24) |
| InChIKey | GYTWWDYYACONSA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |