C22H25N3O3S2 — CID 86876918
N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]oxamide (PubChem CID 86876918) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]oxamide.
| Compound Name | N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 86876918 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[2-(1,3-thiazol-4-ylmethoxy)phenyl]oxamide |
| SMILES | CCC(CC)C(NC(=O)C(=O)Nc1ccccc1OCc1cscn1)c1cccs1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-3-15(4-2)20(19-10-7-11-30-19)25-22(27)21(26)24-17-8-5-6-9-18(17)28-12-16-13-29-14-23-16/h5-11,13-15,20H,3-4,12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | VGUYXKSTEVXVOD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|