C18H22FNOS — CID 51966644
N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-(2-fluorophenyl)acetamide (PubChem CID 51966644) has the molecular formula C18H22FNOS and a molecular weight of 319.44 g/mol. Its IUPAC name is N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 51966644 |
| Molecular Formula | C18H22FNOS |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-(2-fluorophenyl)acetamide |
| SMILES | CCC(CC)[C@@H](NC(=O)Cc1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C18H22FNOS/c1-3-13(4-2)18(16-10-7-11-22-16)20-17(21)12-14-8-5-6-9-15(14)19/h5-11,13,18H,3-4,12H2,1-2H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | HCZHMWPVSMCRGK-GOSISDBHSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |