C15H27ClN2OS — CID 119300993
2-amino-N-(2-ethyl-1-thiophen-2-ylbutyl)pentanamide;hydrochloride (PubChem CID 119300993) has the molecular formula C15H27ClN2OS and a molecular weight of 318.91 g/mol. Its IUPAC name is 2-amino-N-(2-ethyl-1-thiophen-2-ylbutyl)pentanamide;hydrochloride.
| Compound Name | 2-amino-N-(2-ethyl-1-thiophen-2-ylbutyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119300993 |
| Molecular Formula | C15H27ClN2OS |
| Molecular Weight | 318.91 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-amino-N-(2-ethyl-1-thiophen-2-ylbutyl)pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)NC(c1cccs1)C(CC)CC.Cl |
| InChI | InChI=1S/C15H26N2OS.ClH/c1-4-8-12(16)15(18)17-14(11(5-2)6-3)13-9-7-10-19-13;/h7,9-12,14H,4-6,8,16H2,1-3H3,(H,17,18);1H |
| InChIKey | VKOBRYSTFAEUSA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |