C15H25NO3S2 — CID 94635932
N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-propan-2-ylsulfonylacetamide (PubChem CID 94635932) has the molecular formula C15H25NO3S2 and a molecular weight of 331.50 g/mol. Its IUPAC name is N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-propan-2-ylsulfonylacetamide.
| Compound Name | N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-propan-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 94635932 |
| Molecular Formula | C15H25NO3S2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]-2-propan-2-ylsulfonylacetamide |
| SMILES | CCC(CC)[C@@H](NC(=O)CS(=O)(=O)C(C)C)c1cccs1 |
| InChI | InChI=1S/C15H25NO3S2/c1-5-12(6-2)15(13-8-7-9-20-13)16-14(17)10-21(18,19)11(3)4/h7-9,11-12,15H,5-6,10H2,1-4H3,(H,16,17)/t15-/m1/s1 |
| InChIKey | ZDNRXFLZBAMEFD-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |