C11H17NO3S2 — CID 39033410
N-[(2S)-butan-2-yl]-2-(thiophen-2-ylmethylsulfonyl)acetamide (PubChem CID 39033410) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-(thiophen-2-ylmethylsulfonyl)acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-(thiophen-2-ylmethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 39033410 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-(thiophen-2-ylmethylsulfonyl)acetamide |
| SMILES | CC[C@H](C)NC(=O)CS(=O)(=O)Cc1cccs1 |
| InChI | InChI=1S/C11H17NO3S2/c1-3-9(2)12-11(13)8-17(14,15)7-10-5-4-6-16-10/h4-6,9H,3,7-8H2,1-2H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | ANJFNGFZXMFPPT-VIFPVBQESA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |