C10H14N2OS2 — CID 62092047
N-(4-amino-4-sulfanylidenebutan-2-yl)-2-thiophen-2-ylacetamide (PubChem CID 62092047) has the molecular formula C10H14N2OS2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 62092047 |
| Molecular Formula | C10H14N2OS2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2-thiophen-2-ylacetamide |
| SMILES | CC(CC(N)=S)NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C10H14N2OS2/c1-7(5-9(11)14)12-10(13)6-8-3-2-4-15-8/h2-4,7H,5-6H2,1H3,(H2,11,14)(H,12,13) |
| InChIKey | ZGWRWZXGVNEPQO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|