C9H12N2OS2 — CID 61120272
N-(1-amino-1-sulfanylidenepropan-2-yl)-2-thiophen-2-ylacetamide (PubChem CID 61120272) has the molecular formula C9H12N2OS2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 61120272 |
| Molecular Formula | C9H12N2OS2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-2-thiophen-2-ylacetamide |
| SMILES | CC(NC(=O)Cc1cccs1)C(N)=S |
| InChI | InChI=1S/C9H12N2OS2/c1-6(9(10)13)11-8(12)5-7-3-2-4-14-7/h2-4,6H,5H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | UYOLJXSFUIPECO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|