C15H16ClNOS — CID 51947501
N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 51947501) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 51947501 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | C[C@@H](Cc1cccc(Cl)c1)NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C15H16ClNOS/c1-11(8-12-4-2-5-13(16)9-12)17-15(18)10-14-6-3-7-19-14/h2-7,9,11H,8,10H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | WDNCKDBDQFBFRK-NSHDSACASA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |