C15H23ClN2O — CID 78972710
2-(tert-butylamino)-N-[1-(3-chlorophenyl)propan-2-yl]acetamide (PubChem CID 78972710) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-[1-(3-chlorophenyl)propan-2-yl]acetamide.
| Compound Name | 2-(tert-butylamino)-N-[1-(3-chlorophenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 78972710 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(tert-butylamino)-N-[1-(3-chlorophenyl)propan-2-yl]acetamide |
| SMILES | CC(Cc1cccc(Cl)c1)NC(=O)CNC(C)(C)C |
| InChI | InChI=1S/C15H23ClN2O/c1-11(8-12-6-5-7-13(16)9-12)18-14(19)10-17-15(2,3)4/h5-7,9,11,17H,8,10H2,1-4H3,(H,18,19) |
| InChIKey | WDVZHWMERLNQOZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |