C20H19ClN2O3 — CID 51950189
N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 51950189) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 51950189 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@@H](Cc1cccc(Cl)c1)NC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H19ClN2O3/c1-13(11-14-5-4-6-15(21)12-14)22-18(24)9-10-23-19(25)16-7-2-3-8-17(16)20(23)26/h2-8,12-13H,9-11H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | QGBXAWVACVTBCO-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|