C16H26ClN — CID 81015548
N-tert-butyl-4-(3-chlorophenyl)-2,3-dimethylbutan-1-amine (PubChem CID 81015548) has the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. Its IUPAC name is N-tert-butyl-4-(3-chlorophenyl)-2,3-dimethylbutan-1-amine.
| Compound Name | N-tert-butyl-4-(3-chlorophenyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81015548 |
| Molecular Formula | C16H26ClN |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-tert-butyl-4-(3-chlorophenyl)-2,3-dimethylbutan-1-amine |
| SMILES | CC(CNC(C)(C)C)C(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClN/c1-12(13(2)11-18-16(3,4)5)9-14-7-6-8-15(17)10-14/h6-8,10,12-13,18H,9,11H2,1-5H3 |
| InChIKey | LKEYRSDGMGFTRA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |