C16H19NOS2 — CID 43044656
N-butan-2-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 43044656) has the molecular formula C16H19NOS2 and a molecular weight of 305.47 g/mol. Its IUPAC name is N-butan-2-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-butan-2-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 43044656 |
| Molecular Formula | C16H19NOS2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-butan-2-yl-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C16H19NOS2/c1-3-12(2)17-16(18)14-8-4-5-9-15(14)20-11-13-7-6-10-19-13/h4-10,12H,3,11H2,1-2H3,(H,17,18) |
| InChIKey | HVXILGPDGAYCAF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |