C20H18N2O3S2 — CID 55804766
methyl N-[4-[[2-(thiophen-2-ylmethylsulfanyl)benzoyl]amino]phenyl]carbamate (PubChem CID 55804766) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is methyl N-[4-[[2-(thiophen-2-ylmethylsulfanyl)benzoyl]amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[[2-(thiophen-2-ylmethylsulfanyl)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55804766 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | methyl N-[4-[[2-(thiophen-2-ylmethylsulfanyl)benzoyl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)c2ccccc2SCc2cccs2)cc1 |
| InChI | InChI=1S/C20H18N2O3S2/c1-25-20(24)22-15-10-8-14(9-11-15)21-19(23)17-6-2-3-7-18(17)27-13-16-5-4-12-26-16/h2-12H,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | RBHDTOFZRUMSIY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |