C24H27N3OS2 — CID 47072037
N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 47072037) has the molecular formula C24H27N3OS2 and a molecular weight of 437.63 g/mol. Its IUPAC name is N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 47072037 |
| Molecular Formula | C24H27N3OS2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | CN1CCN(Cc2cccc(NC(=O)c3ccccc3SCc3cccs3)c2)CC1 |
| InChI | InChI=1S/C24H27N3OS2/c1-26-11-13-27(14-12-26)17-19-6-4-7-20(16-19)25-24(28)22-9-2-3-10-23(22)30-18-21-8-5-15-29-21/h2-10,15-16H,11-14,17-18H2,1H3,(H,25,28) |
| InChIKey | XYECBARWLUTIGW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |