C24H20N2OS3 — CID 36542663
N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 36542663) has the molecular formula C24H20N2OS3 and a molecular weight of 448.64 g/mol. Its IUPAC name is N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 36542663 |
| Molecular Formula | C24H20N2OS3 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C24H20N2OS3/c27-24(22-7-1-2-8-23(22)30-17-21-6-4-14-28-21)26-19-9-11-20(12-10-19)29-16-18-5-3-13-25-15-18/h1-15H,16-17H2,(H,26,27) |
| InChIKey | DOAPSSIKGHCWRC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |