C21H28FN3OS — CID 24566759
2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide (PubChem CID 24566759) has the molecular formula C21H28FN3OS and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 24566759 |
| Molecular Formula | C21H28FN3OS |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-(2-methyl-1-thiophen-2-ylpropyl)acetamide |
| SMILES | CC(C)C(NC(=O)CN1CCN(Cc2ccccc2F)CC1)c1cccs1 |
| InChI | InChI=1S/C21H28FN3OS/c1-16(2)21(19-8-5-13-27-19)23-20(26)15-25-11-9-24(10-12-25)14-17-6-3-4-7-18(17)22/h3-8,13,16,21H,9-12,14-15H2,1-2H3,(H,23,26) |
| InChIKey | WOZYXSZZVWUYFM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |