C18H18N2O3S — CID 9051678
2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide (PubChem CID 9051678) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 9051678 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide |
| SMILES | CC(C)[C@H](NC(=O)CN1C(=O)c2ccccc2C1=O)c1cccs1 |
| InChI | InChI=1S/C18H18N2O3S/c1-11(2)16(14-8-5-9-24-14)19-15(21)10-20-17(22)12-6-3-4-7-13(12)18(20)23/h3-9,11,16H,10H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | WHWMFENVKPNDEF-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|