C20H24FNO2S2 — CID 55904162
2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-ethyl-1-thiophen-2-ylbutyl)acetamide (PubChem CID 55904162) has the molecular formula C20H24FNO2S2 and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-ethyl-1-thiophen-2-ylbutyl)acetamide.
| Compound Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-ethyl-1-thiophen-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 55904162 |
| Molecular Formula | C20H24FNO2S2 |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-(2-ethyl-1-thiophen-2-ylbutyl)acetamide |
| SMILES | CCC(CC)C(NC(=O)CSc1ccc(C(C)=O)cc1F)c1cccs1 |
| InChI | InChI=1S/C20H24FNO2S2/c1-4-14(5-2)20(18-7-6-10-25-18)22-19(24)12-26-17-9-8-15(13(3)23)11-16(17)21/h6-11,14,20H,4-5,12H2,1-3H3,(H,22,24) |
| InChIKey | MHVILSYLYLLOPV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |