C21H24FNO3S — CID 55713467
2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[1-(3-propan-2-yloxyphenyl)ethyl]acetamide (PubChem CID 55713467) has the molecular formula C21H24FNO3S and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[1-(3-propan-2-yloxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[1-(3-propan-2-yloxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55713467 |
| Molecular Formula | C21H24FNO3S |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[1-(3-propan-2-yloxyphenyl)ethyl]acetamide |
| SMILES | CC(=O)c1ccc(SCC(=O)NC(C)c2cccc(OC(C)C)c2)c(F)c1 |
| InChI | InChI=1S/C21H24FNO3S/c1-13(2)26-18-7-5-6-16(10-18)14(3)23-21(25)12-27-20-9-8-17(15(4)24)11-19(20)22/h5-11,13-14H,12H2,1-4H3,(H,23,25) |
| InChIKey | WLYMZOQTQAGYNU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |