C12H13NO2S — CID 78931487
(1S)-1-[2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol (PubChem CID 78931487) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is (1S)-1-[2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 78931487 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (1S)-1-[2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol |
| SMILES | C[C@H](O)c1ccccc1OCc1cscn1 |
| InChI | InChI=1S/C12H13NO2S/c1-9(14)11-4-2-3-5-12(11)15-6-10-7-16-8-13-10/h2-5,7-9,14H,6H2,1H3/t9-/m0/s1 |
| InChIKey | AQDYTTGQQMIVQF-VIFPVBQESA-N |
| XLogP | 2.78 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |