C12H12N2O4S — CID 116541977
1-[5-nitro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol (PubChem CID 116541977) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-[5-nitro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol.
| Compound Name | 1-[5-nitro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 116541977 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-[5-nitro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanol |
| SMILES | CC(O)c1cc([N+](=O)[O-])ccc1OCc1cscn1 |
| InChI | InChI=1S/C12H12N2O4S/c1-8(15)11-4-10(14(16)17)2-3-12(11)18-5-9-6-19-7-13-9/h2-4,6-8,15H,5H2,1H3 |
| InChIKey | ZLJPQIHAKWLYFZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|