About 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate
1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate (PubChem CID 112643735) has the molecular formula C10H10N2O2S2
and a molecular weight of 254.34 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate.
Analyze 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
The IUPAC name of 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate (CID 112643735) is 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
The canonical SMILES for 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate is Cc1sc(C(=O)OCc2cncs2)cc1N.
What is the InChIKey of 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
The InChIKey is SSMSQKIYLZQFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c1-6-8(11)2-9(16-6)10(13)14-4-7-3-12-5-15-7/h2-3,5H,4,11H2,1H3.
What are the key properties of 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate has a molecular weight of 254.34 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl 4-amino-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 112643735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).