About 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate
3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate (PubChem CID 61481561) has the molecular formula C12H19NO2S
and a molecular weight of 241.36 g/mol. Its IUPAC name is 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate.
Analyze 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate?
The IUPAC name of 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate (CID 61481561) is 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate.
What is the SMILES notation for 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate?
The canonical SMILES for 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate is Cc1sc(C(=O)OCCC(C)(C)C)cc1N.
What is the InChIKey of 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate?
The InChIKey is VJAPDWHJOGQMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2S/c1-8-9(13)7-10(16-8)11(14)15-6-5-12(2,3)4/h7H,5-6,13H2,1-4H3.
What are the key properties of 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate?
3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate has a molecular weight of 241.36 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutyl 4-amino-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 61481561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).