About pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate
pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate (PubChem CID 55108746) has the molecular formula C11H11N3O2S
and a molecular weight of 249.30 g/mol. Its IUPAC name is pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate |
| PubChem CID | 55108746 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate |
| SMILES | Cc1sc(C(=O)OCc2ncccn2)cc1N |
| InChI | InChI=1S/C11H11N3O2S/c1-7-8(12)5-9(17-7)11(15)16-6-10-13-3-2-4-14-10/h2-5H,6,12H2,1H3 |
| InChIKey | JXZCJPZHISRMIO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
The IUPAC name of pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate (CID 55108746) is pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate.
What is the SMILES notation for pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
The canonical SMILES for pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate is Cc1sc(C(=O)OCc2ncccn2)cc1N.
What is the InChIKey of pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
The InChIKey is JXZCJPZHISRMIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S/c1-7-8(12)5-9(17-7)11(15)16-6-10-13-3-2-4-14-10/h2-5H,6,12H2,1H3.
What are the key properties of pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate?
pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate has a molecular weight of 249.30 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-2-ylmethyl 4-amino-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 55108746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).