About 1-ethoxyethenyl 5-methylpyridine-3-carboxylate
1-ethoxyethenyl 5-methylpyridine-3-carboxylate (PubChem CID 135150396) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-ethoxyethenyl 5-methylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | 1-ethoxyethenyl 5-methylpyridine-3-carboxylate |
| PubChem CID | 135150396 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-ethoxyethenyl 5-methylpyridine-3-carboxylate |
| SMILES | C=C(OCC)OC(=O)c1cncc(C)c1 |
| InChI | InChI=1S/C11H13NO3/c1-4-14-9(3)15-11(13)10-5-8(2)6-12-7-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | CZTIJNBHLNSVSP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethenyl 5-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethenyl 5-methylpyridine-3-carboxylate?
The IUPAC name of 1-ethoxyethenyl 5-methylpyridine-3-carboxylate (CID 135150396) is 1-ethoxyethenyl 5-methylpyridine-3-carboxylate.
What is the SMILES notation for 1-ethoxyethenyl 5-methylpyridine-3-carboxylate?
The canonical SMILES for 1-ethoxyethenyl 5-methylpyridine-3-carboxylate is C=C(OCC)OC(=O)c1cncc(C)c1.
What is the InChIKey of 1-ethoxyethenyl 5-methylpyridine-3-carboxylate?
The InChIKey is CZTIJNBHLNSVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-4-14-9(3)15-11(13)10-5-8(2)6-12-7-10/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-ethoxyethenyl 5-methylpyridine-3-carboxylate?
1-ethoxyethenyl 5-methylpyridine-3-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethenyl 5-methylpyridine-3-carboxylate is sourced from PubChem (CID 135150396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).