About 2-methylpropane;5-methylpyridine-3-carboxamide
2-methylpropane;5-methylpyridine-3-carboxamide (PubChem CID 165136425) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-methylpropane;5-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-methylpropane;5-methylpyridine-3-carboxamide |
| PubChem CID | 165136425 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-methylpropane;5-methylpyridine-3-carboxamide |
| SMILES | CC(C)C.Cc1cncc(C(N)=O)c1 |
| InChI | InChI=1S/C7H8N2O.C4H10/c1-5-2-6(7(8)10)4-9-3-5;1-4(2)3/h2-4H,1H3,(H2,8,10);4H,1-3H3 |
| InChIKey | OPDCBHQTXYAOCR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropane;5-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;5-methylpyridine-3-carboxamide?
The IUPAC name of 2-methylpropane;5-methylpyridine-3-carboxamide (CID 165136425) is 2-methylpropane;5-methylpyridine-3-carboxamide.
What is the SMILES notation for 2-methylpropane;5-methylpyridine-3-carboxamide?
The canonical SMILES for 2-methylpropane;5-methylpyridine-3-carboxamide is CC(C)C.Cc1cncc(C(N)=O)c1.
What is the InChIKey of 2-methylpropane;5-methylpyridine-3-carboxamide?
The InChIKey is OPDCBHQTXYAOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C4H10/c1-5-2-6(7(8)10)4-9-3-5;1-4(2)3/h2-4H,1H3,(H2,8,10);4H,1-3H3.
What are the key properties of 2-methylpropane;5-methylpyridine-3-carboxamide?
2-methylpropane;5-methylpyridine-3-carboxamide has a molecular weight of 194.28 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;5-methylpyridine-3-carboxamide is sourced from PubChem (CID 165136425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).