C20H31N5O2S — CID 87928623
1,3-thiazol-5-ylmethyl N-[4-[2-[(2-phenylethylamino)methylamino]ethylamino]butyl]carbamate (PubChem CID 87928623) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[4-[2-[(2-phenylethylamino)methylamino]ethylamino]butyl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[4-[2-[(2-phenylethylamino)methylamino]ethylamino]butyl]carbamate |
|---|---|
| PubChem CID | 87928623 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[4-[2-[(2-phenylethylamino)methylamino]ethylamino]butyl]carbamate |
| SMILES | O=C(NCCCCNCCNCNCCc1ccccc1)OCc1cncs1 |
| InChI | InChI=1S/C20H31N5O2S/c26-20(27-15-19-14-24-17-28-19)25-10-5-4-9-21-12-13-23-16-22-11-8-18-6-2-1-3-7-18/h1-3,6-7,14,17,21-23H,4-5,8-13,15-16H2,(H,25,26) |
| InChIKey | KTPBJCQFLDMYSH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|