C16H20N2O2S — CID 123306319
1,3-thiazol-5-ylmethyl N-(1-phenylpentan-2-yl)carbamate (PubChem CID 123306319) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-(1-phenylpentan-2-yl)carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-(1-phenylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 123306319 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-(1-phenylpentan-2-yl)carbamate |
| SMILES | CCCC(Cc1ccccc1)NC(=O)OCc1cncs1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-6-14(9-13-7-4-3-5-8-13)18-16(19)20-11-15-10-17-12-21-15/h3-5,7-8,10,12,14H,2,6,9,11H2,1H3,(H,18,19) |
| InChIKey | XVZUSTZSCSBIPN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |