C28H32N4O4S2 — CID 163443172
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-(2,3-dihydro-1,3-thiazol-5-ylmethoxycarbonylamino)-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 163443172) has the molecular formula C28H32N4O4S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-(2,3-dihydro-1,3-thiazol-5-ylmethoxycarbonylamino)-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-(2,3-dihydro-1,3-thiazol-5-ylmethoxycarbonylamino)-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 163443172 |
| Molecular Formula | C28H32N4O4S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-(2,3-dihydro-1,3-thiazol-5-ylmethoxycarbonylamino)-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CC[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1)OCC1=CNCS1 |
| InChI | InChI=1S/C28H32N4O4S2/c33-27(35-17-25-15-29-19-37-25)31-23(13-21-7-3-1-4-8-21)11-12-24(14-22-9-5-2-6-10-22)32-28(34)36-18-26-16-30-20-38-26/h1-10,15-16,19,23-24,30H,11-14,17-18,20H2,(H,31,33)(H,32,34)/t23-,24-/m1/s1 |
| InChIKey | BAHCIEOVNPBOTC-DNQXCXABSA-N |
| XLogP | 5.23 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |