C35H43N5O6S2 — CID 66639827
methyl 6-[bis[(2R)-3-phenyl-2-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]hexanoate (PubChem CID 66639827) has the molecular formula C35H43N5O6S2 and a molecular weight of 693.89 g/mol. Its IUPAC name is methyl 6-[bis[(2R)-3-phenyl-2-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]hexanoate.
| Compound Name | methyl 6-[bis[(2R)-3-phenyl-2-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]hexanoate |
|---|---|
| PubChem CID | 66639827 |
| Molecular Formula | C35H43N5O6S2 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | methyl 6-[bis[(2R)-3-phenyl-2-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCN(C[C@@H](Cc1ccccc1)NC(=O)OCc1cncs1)C[C@@H](Cc1ccccc1)NC(=O)OCc1cncs1 |
| InChI | InChI=1S/C35H43N5O6S2/c1-44-33(41)15-9-4-10-16-40(21-29(17-27-11-5-2-6-12-27)38-34(42)45-23-31-19-36-25-47-31)22-30(18-28-13-7-3-8-14-28)39-35(43)46-24-32-20-37-26-48-32/h2-3,5-8,11-14,19-20,25-26,29-30H,4,9-10,15-18,21-24H2,1H3,(H,38,42)(H,39,43)/t29-,30-/m1/s1 |
| InChIKey | WNNKIBGWRIKSHZ-LOYHVIPDSA-N |
| XLogP | 6.01 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|