C33H40N6O4S2 — CID 59721345
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 59721345) has the molecular formula C33H40N6O4S2 and a molecular weight of 648.86 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59721345 |
| Molecular Formula | C33H40N6O4S2 |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-2-[[methyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC[C@H](NC(=O)N(C)Cc1cncs1)C(=O)N[C@H](CC[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C33H40N6O4S2/c1-3-30(38-32(41)39(2)20-28-18-34-22-44-28)31(40)36-26(16-24-10-6-4-7-11-24)14-15-27(17-25-12-8-5-9-13-25)37-33(42)43-21-29-19-35-23-45-29/h4-13,18-19,22-23,26-27,30H,3,14-17,20-21H2,1-2H3,(H,36,40)(H,37,42)(H,38,41)/t26-,27-,30+/m1/s1 |
| InChIKey | LZVBOQADODSCMK-ZKKGZRQESA-N |
| XLogP | 5.57 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |