C17H22N4O6S2 — CID 25094936
ethyl 2-[1,3-thiazol-5-ylmethoxycarbonyl-[3-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]acetate (PubChem CID 25094936) has the molecular formula C17H22N4O6S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is ethyl 2-[1,3-thiazol-5-ylmethoxycarbonyl-[3-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]acetate.
| Compound Name | ethyl 2-[1,3-thiazol-5-ylmethoxycarbonyl-[3-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]acetate |
|---|---|
| PubChem CID | 25094936 |
| Molecular Formula | C17H22N4O6S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | ethyl 2-[1,3-thiazol-5-ylmethoxycarbonyl-[3-(1,3-thiazol-5-ylmethoxycarbonylamino)propyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCCNC(=O)OCc1cncs1)C(=O)OCc1cncs1 |
| InChI | InChI=1S/C17H22N4O6S2/c1-2-25-15(22)8-21(17(24)27-10-14-7-19-12-29-14)5-3-4-20-16(23)26-9-13-6-18-11-28-13/h6-7,11-12H,2-5,8-10H2,1H3,(H,20,23) |
| InChIKey | DPRQHRJBRPIAEM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|