C12H21N3O2S — CID 115732318
tert-butyl N-[3-(1,3-thiazol-5-ylmethylamino)propyl]carbamate (PubChem CID 115732318) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is tert-butyl N-[3-(1,3-thiazol-5-ylmethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(1,3-thiazol-5-ylmethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 115732318 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | tert-butyl N-[3-(1,3-thiazol-5-ylmethylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCc1cncs1 |
| InChI | InChI=1S/C12H21N3O2S/c1-12(2,3)17-11(16)15-6-4-5-13-7-10-8-14-9-18-10/h8-9,13H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | IYIQBCAGFKGJFA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|