C15H26N4O2S — CID 103792925
tert-butyl 4-[2-(1,3-thiazol-5-ylmethylamino)ethyl]piperazine-1-carboxylate (PubChem CID 103792925) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is tert-butyl 4-[2-(1,3-thiazol-5-ylmethylamino)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1,3-thiazol-5-ylmethylamino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 103792925 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl 4-[2-(1,3-thiazol-5-ylmethylamino)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCNCc2cncs2)CC1 |
| InChI | InChI=1S/C15H26N4O2S/c1-15(2,3)21-14(20)19-8-6-18(7-9-19)5-4-16-10-13-11-17-12-22-13/h11-12,16H,4-10H2,1-3H3 |
| InChIKey | FFIJLPWHFQACPS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|