C12H19N3O2S — CID 67394506
1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate (PubChem CID 67394506) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate |
|---|---|
| PubChem CID | 67394506 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-(2-piperidin-4-ylethyl)carbamate |
| SMILES | O=C(NCCC1CCNCC1)OCc1cncs1 |
| InChI | InChI=1S/C12H19N3O2S/c16-12(17-8-11-7-14-9-18-11)15-6-3-10-1-4-13-5-2-10/h7,9-10,13H,1-6,8H2,(H,15,16) |
| InChIKey | MNNOXTHDIGSFEE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |