C16H30N2O6 — CID 19020689
butanedioic acid;tert-butyl N-(2-piperidin-4-ylethyl)carbamate (PubChem CID 19020689) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is butanedioic acid;tert-butyl N-(2-piperidin-4-ylethyl)carbamate.
| Compound Name | butanedioic acid;tert-butyl N-(2-piperidin-4-ylethyl)carbamate |
|---|---|
| PubChem CID | 19020689 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | butanedioic acid;tert-butyl N-(2-piperidin-4-ylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1CCNCC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C12H24N2O2.C4H6O4/c1-12(2,3)16-11(15)14-9-6-10-4-7-13-8-5-10;5-3(6)1-2-4(7)8/h10,13H,4-9H2,1-3H3,(H,14,15);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | UKEFSLNAGXLZTD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |