C17H33N3O4 — CID 90457113
tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-piperidin-4-ylcarbamate (PubChem CID 90457113) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-piperidin-4-ylcarbamate.
| Compound Name | tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-piperidin-4-ylcarbamate |
|---|---|
| PubChem CID | 90457113 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(C(=O)OC(C)(C)C)C1CCNCC1 |
| InChI | InChI=1S/C17H33N3O4/c1-16(2,3)23-14(21)19-11-12-20(13-7-9-18-10-8-13)15(22)24-17(4,5)6/h13,18H,7-12H2,1-6H3,(H,19,21) |
| InChIKey | ATUJICNYPCQXJH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |