C18H35N3O4 — CID 130191685
tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-(pyrrolidin-3-ylmethyl)carbamate (PubChem CID 130191685) has the molecular formula C18H35N3O4 and a molecular weight of 357.50 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-(pyrrolidin-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-(pyrrolidin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 130191685 |
| Molecular Formula | C18H35N3O4 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-(pyrrolidin-3-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CC1CCNC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35N3O4/c1-17(2,3)24-15(22)20-9-7-11-21(13-14-8-10-19-12-14)16(23)25-18(4,5)6/h14,19H,7-13H2,1-6H3,(H,20,22) |
| InChIKey | VLJKTRUSFIZDJU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|