C17H31BrN2O3 — CID 91537220
tert-butyl N-[2-[(2-bromo-2-methylpropanoyl)-cyclohexylamino]ethyl]carbamate (PubChem CID 91537220) has the molecular formula C17H31BrN2O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-bromo-2-methylpropanoyl)-cyclohexylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-bromo-2-methylpropanoyl)-cyclohexylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 91537220 |
| Molecular Formula | C17H31BrN2O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | tert-butyl N-[2-[(2-bromo-2-methylpropanoyl)-cyclohexylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(C(=O)C(C)(C)Br)C1CCCCC1 |
| InChI | InChI=1S/C17H31BrN2O3/c1-16(2,3)23-15(22)19-11-12-20(14(21)17(4,5)18)13-9-7-6-8-10-13/h13H,6-12H2,1-5H3,(H,19,22) |
| InChIKey | NUMZFIQJPAGZKW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|