C21H32N2O3 — CID 24632584
tert-butyl N-[[4-[cyclohexyl(ethyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 24632584) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl N-[[4-[cyclohexyl(ethyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[cyclohexyl(ethyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 24632584 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | tert-butyl N-[[4-[cyclohexyl(ethyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | CCN(C(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H32N2O3/c1-5-23(18-9-7-6-8-10-18)19(24)17-13-11-16(12-14-17)15-22-20(25)26-21(2,3)4/h11-14,18H,5-10,15H2,1-4H3,(H,22,25) |
| InChIKey | KUWCBYINHQEKET-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |